C56H64N2Si2 — CID 102335535
4-[12-(4-aminophenyl)-6,9-diphenyl-1,14-bis[tri(propan-2-yl)silyl]tetradeca-3,4,5,9,10,11-hexaen-1,7,13-triyn-3-yl]aniline (PubChem CID 102335535) has the molecular formula C56H64N2Si2 and a molecular weight of 821.31 g/mol. Its IUPAC name is 4-[12-(4-aminophenyl)-6,9-diphenyl-1,14-bis[tri(propan-2-yl)silyl]tetradeca-3,4,5,9,10,11-hexaen-1,7,13-triyn-3-yl]aniline.
| Compound Name | 4-[12-(4-aminophenyl)-6,9-diphenyl-1,14-bis[tri(propan-2-yl)silyl]tetradeca-3,4,5,9,10,11-hexaen-1,7,13-triyn-3-yl]aniline |
|---|---|
| PubChem CID | 102335535 |
| Molecular Formula | C56H64N2Si2 |
| Molecular Weight | 821.31 g/mol |
| Exact Mass | 820.46 |
| IUPAC Name | 4-[12-(4-aminophenyl)-6,9-diphenyl-1,14-bis[tri(propan-2-yl)silyl]tetradeca-3,4,5,9,10,11-hexaen-1,7,13-triyn-3-yl]aniline |
| SMILES | CC(C)[Si](C#CC(=C=C=C(C#CC(=C=C=C(C#C[Si](C(C)C)(C(C)C)C(C)C)c1ccc(N)cc1)c1ccccc1)c1ccccc1)c1ccc(N)cc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C56H64N2Si2/c1-41(2)59(42(3)4,43(5)6)39-37-53(51-29-33-55(57)34-30-51)27-25-49(47-19-15-13-16-20-47)23-24-50(48-21-17-14-18-22-48)26-28-54(52-31-35-56(58)36-32-52)38-40-60(44(7)8,45(9)10)46(11)12/h13-22,29-36,41-46H,57-58H2,1-12H3/b53-49-,54-50- |
| InChIKey | CXVORXUVYBFUOA-MOLKATJNSA-N |
| XLogP | 14.44 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.31 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|