C24H17F3O3 — CID 102335749
methyl 5-(naphthalen-1-ylmethyl)-4-phenyl-2-(trifluoromethyl)furan-3-carboxylate (PubChem CID 102335749) has the molecular formula C24H17F3O3 and a molecular weight of 410.39 g/mol. Its IUPAC name is methyl 5-(naphthalen-1-ylmethyl)-4-phenyl-2-(trifluoromethyl)furan-3-carboxylate.
| Compound Name | methyl 5-(naphthalen-1-ylmethyl)-4-phenyl-2-(trifluoromethyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 102335749 |
| Molecular Formula | C24H17F3O3 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | methyl 5-(naphthalen-1-ylmethyl)-4-phenyl-2-(trifluoromethyl)furan-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)(F)F)oc(Cc2cccc3ccccc23)c1-c1ccccc1 |
| InChI | InChI=1S/C24H17F3O3/c1-29-23(28)21-20(16-9-3-2-4-10-16)19(30-22(21)24(25,26)27)14-17-12-7-11-15-8-5-6-13-18(15)17/h2-13H,14H2,1H3 |
| InChIKey | POUMPEIAGLWPOP-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |