C30H22N2O2S — CID 102335857
methyl (10R,11S,12S)-21,21-dicyano-11-phenyl-8-thiapentacyclo[11.8.0.01,10.02,7.015,20]henicosa-2,4,6,13,15,17,19-heptaene-12-carboxylate (PubChem CID 102335857) has the molecular formula C30H22N2O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is methyl (10R,11S,12S)-21,21-dicyano-11-phenyl-8-thiapentacyclo[11.8.0.01,10.02,7.015,20]henicosa-2,4,6,13,15,17,19-heptaene-12-carboxylate.
| Compound Name | methyl (10R,11S,12S)-21,21-dicyano-11-phenyl-8-thiapentacyclo[11.8.0.01,10.02,7.015,20]henicosa-2,4,6,13,15,17,19-heptaene-12-carboxylate |
|---|---|
| PubChem CID | 102335857 |
| Molecular Formula | C30H22N2O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | methyl (10R,11S,12S)-21,21-dicyano-11-phenyl-8-thiapentacyclo[11.8.0.01,10.02,7.015,20]henicosa-2,4,6,13,15,17,19-heptaene-12-carboxylate |
| SMILES | COC(=O)[C@@H]1C2=Cc3ccccc3C(C#N)(C#N)C23c2ccccc2SC[C@@H]3[C@H]1c1ccccc1 |
| InChI | InChI=1S/C30H22N2O2S/c1-34-28(33)27-23-15-20-11-5-6-12-21(20)29(17-31,18-32)30(23)22-13-7-8-14-25(22)35-16-24(30)26(27)19-9-3-2-4-10-19/h2-15,24,26-27H,16H2,1H3/t24-,26-,27-,30?/m1/s1 |
| InChIKey | PTAWTAROXCOGHN-LOQIKKFYSA-N |
| XLogP | 5.62 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |