C26H22N2O2S — CID 102335860
methyl (11S,12S,13R)-2,2-dicyano-12-phenyl-15-thiatetracyclo[8.7.0.01,13.03,8]heptadeca-3,5,7,9-tetraene-11-carboxylate (PubChem CID 102335860) has the molecular formula C26H22N2O2S and a molecular weight of 426.54 g/mol. Its IUPAC name is methyl (11S,12S,13R)-2,2-dicyano-12-phenyl-15-thiatetracyclo[8.7.0.01,13.03,8]heptadeca-3,5,7,9-tetraene-11-carboxylate.
| Compound Name | methyl (11S,12S,13R)-2,2-dicyano-12-phenyl-15-thiatetracyclo[8.7.0.01,13.03,8]heptadeca-3,5,7,9-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 102335860 |
| Molecular Formula | C26H22N2O2S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | methyl (11S,12S,13R)-2,2-dicyano-12-phenyl-15-thiatetracyclo[8.7.0.01,13.03,8]heptadeca-3,5,7,9-tetraene-11-carboxylate |
| SMILES | COC(=O)[C@@H]1C2=Cc3ccccc3C(C#N)(C#N)C23CCSC[C@@H]3[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H22N2O2S/c1-30-24(29)23-20-13-18-9-5-6-10-19(18)25(15-27,16-28)26(20)11-12-31-14-21(26)22(23)17-7-3-2-4-8-17/h2-10,13,21-23H,11-12,14H2,1H3/t21-,22-,23-,26?/m1/s1 |
| InChIKey | QAJRRBRKVPWSAM-FUKBKCBYSA-N |
| XLogP | 4.69 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |