C13H17NO — CID 102336590
1-(1-benzofuran-5-yl)-N-ethylpropan-2-amine (PubChem CID 102336590) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-(1-benzofuran-5-yl)-N-ethylpropan-2-amine.
| Compound Name | 1-(1-benzofuran-5-yl)-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 102336590 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-(1-benzofuran-5-yl)-N-ethylpropan-2-amine |
| SMILES | CCNC(C)Cc1ccc2occc2c1 |
| InChI | InChI=1S/C13H17NO/c1-3-14-10(2)8-11-4-5-13-12(9-11)6-7-15-13/h4-7,9-10,14H,3,8H2,1-2H3 |
| InChIKey | ZBZDDOARNPAMSP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |