C20H18O2S — CID 102336686
5,7-bis(4-methylphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 102336686) has the molecular formula C20H18O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 5,7-bis(4-methylphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5,7-bis(4-methylphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 102336686 |
| Molecular Formula | C20H18O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5,7-bis(4-methylphenyl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | Cc1ccc(-c2sc(-c3ccc(C)cc3)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C20H18O2S/c1-13-3-7-15(8-4-13)19-17-18(22-12-11-21-17)20(23-19)16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | RZKADLQKTPGKTP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |