C14H17NO6 — CID 102336742
methyl (2S,3R,4S,5S)-2-hydroxy-2-methyl-5-nitro-4-phenyloxane-3-carboxylate (PubChem CID 102336742) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S)-2-hydroxy-2-methyl-5-nitro-4-phenyloxane-3-carboxylate.
| Compound Name | methyl (2S,3R,4S,5S)-2-hydroxy-2-methyl-5-nitro-4-phenyloxane-3-carboxylate |
|---|---|
| PubChem CID | 102336742 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | methyl (2S,3R,4S,5S)-2-hydroxy-2-methyl-5-nitro-4-phenyloxane-3-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)[C@H]([N+](=O)[O-])CO[C@]1(C)O |
| InChI | InChI=1S/C14H17NO6/c1-14(17)12(13(16)20-2)11(9-6-4-3-5-7-9)10(8-21-14)15(18)19/h3-7,10-12,17H,8H2,1-2H3/t10-,11+,12+,14+/m1/s1 |
| InChIKey | UTNPATMGHIDLJH-UHXUPSOCSA-N |
| XLogP | 0.94 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|