C15H19NO6 — CID 102336743
ethyl (2S,3R,4S,5S)-2-hydroxy-2-methyl-5-nitro-4-phenyloxane-3-carboxylate (PubChem CID 102336743) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is ethyl (2S,3R,4S,5S)-2-hydroxy-2-methyl-5-nitro-4-phenyloxane-3-carboxylate.
| Compound Name | ethyl (2S,3R,4S,5S)-2-hydroxy-2-methyl-5-nitro-4-phenyloxane-3-carboxylate |
|---|---|
| PubChem CID | 102336743 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | ethyl (2S,3R,4S,5S)-2-hydroxy-2-methyl-5-nitro-4-phenyloxane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)[C@H]([N+](=O)[O-])CO[C@]1(C)O |
| InChI | InChI=1S/C15H19NO6/c1-3-21-14(17)13-12(10-7-5-4-6-8-10)11(16(19)20)9-22-15(13,2)18/h4-8,11-13,18H,3,9H2,1-2H3/t11-,12+,13+,15+/m1/s1 |
| InChIKey | TYVVEVOLUXWCGA-OSFYFWSMSA-N |
| XLogP | 1.33 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|