C20H21NO6 — CID 102336744
ethyl (2R,3R,4S,5S)-2-hydroxy-5-nitro-2,4-diphenyloxane-3-carboxylate (PubChem CID 102336744) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is ethyl (2R,3R,4S,5S)-2-hydroxy-5-nitro-2,4-diphenyloxane-3-carboxylate.
| Compound Name | ethyl (2R,3R,4S,5S)-2-hydroxy-5-nitro-2,4-diphenyloxane-3-carboxylate |
|---|---|
| PubChem CID | 102336744 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | ethyl (2R,3R,4S,5S)-2-hydroxy-5-nitro-2,4-diphenyloxane-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccccc2)[C@H]([N+](=O)[O-])CO[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C20H21NO6/c1-2-26-19(22)18-17(14-9-5-3-6-10-14)16(21(24)25)13-27-20(18,23)15-11-7-4-8-12-15/h3-12,16-18,23H,2,13H2,1H3/t16-,17+,18+,20+/m1/s1 |
| InChIKey | XLNWBXKCTLSWIB-LXZJYRNTSA-N |
| XLogP | 2.47 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|