About ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate
ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate (PubChem CID 102336751) has the molecular formula C20H19NO5
and a molecular weight of 353.37 g/mol. Its IUPAC name is ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate.
Molecular Properties
| Compound Name | ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate |
| PubChem CID | 102336751 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)OCC([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19NO5/c1-2-25-20(22)18-17(14-9-5-3-6-10-14)16(21(23)24)13-26-19(18)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16?,17-/m0/s1 |
| InChIKey | NCNUGJIOOSBUSE-DJNXLDHESA-N |
| XLogP | 3.42 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate?
The IUPAC name of ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate (CID 102336751) is ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate.
What is the SMILES notation for ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate?
The canonical SMILES for ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate is CCOC(=O)C1=C(c2ccccc2)OCC([N+](=O)[O-])[C@@H]1c1ccccc1.
What is the InChIKey of ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate?
The InChIKey is NCNUGJIOOSBUSE-DJNXLDHESA-N. The full InChI is InChI=1S/C20H19NO5/c1-2-25-20(22)18-17(14-9-5-3-6-10-14)16(21(23)24)13-26-19(18)15-11-7-4-8-12-15/h3-12,16-17H,2,13H2,1H3/t16?,17-/m0/s1.
What are the key properties of ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate?
ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate has a molecular weight of 353.37 g/mol, XLogP of 3.42, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4R)-3-nitro-4,6-diphenyl-3,4-dihydro-2H-pyran-5-carboxylate is sourced from PubChem (CID 102336751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).