C22H15F7N2O2S — CID 102337777
5-[3,3,4,4,5,5-hexafluoro-2-[5-(4-fluorophenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2,4-dimethoxypyrimidine (PubChem CID 102337777) has the molecular formula C22H15F7N2O2S and a molecular weight of 504.43 g/mol. Its IUPAC name is 5-[3,3,4,4,5,5-hexafluoro-2-[5-(4-fluorophenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2,4-dimethoxypyrimidine.
| Compound Name | 5-[3,3,4,4,5,5-hexafluoro-2-[5-(4-fluorophenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2,4-dimethoxypyrimidine |
|---|---|
| PubChem CID | 102337777 |
| Molecular Formula | C22H15F7N2O2S |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 5-[3,3,4,4,5,5-hexafluoro-2-[5-(4-fluorophenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2,4-dimethoxypyrimidine |
| SMILES | COc1ncc(C2=C(c3cc(-c4ccc(F)cc4)sc3C)C(F)(F)C(F)(F)C2(F)F)c(OC)n1 |
| InChI | InChI=1S/C22H15F7N2O2S/c1-10-13(8-15(34-10)11-4-6-12(23)7-5-11)16-17(21(26,27)22(28,29)20(16,24)25)14-9-30-19(33-3)31-18(14)32-2/h4-9H,1-3H3 |
| InChIKey | UYTJQUIWKTXCFQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|