C15H12F3NO — CID 102337966
N-[2-methyl-6-[4-(trifluoromethyl)phenyl]phenyl]formamide (PubChem CID 102337966) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is N-[2-methyl-6-[4-(trifluoromethyl)phenyl]phenyl]formamide.
| Compound Name | N-[2-methyl-6-[4-(trifluoromethyl)phenyl]phenyl]formamide |
|---|---|
| PubChem CID | 102337966 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-[2-methyl-6-[4-(trifluoromethyl)phenyl]phenyl]formamide |
| SMILES | Cc1cccc(-c2ccc(C(F)(F)F)cc2)c1NC=O |
| InChI | InChI=1S/C15H12F3NO/c1-10-3-2-4-13(14(10)19-9-20)11-5-7-12(8-6-11)15(16,17)18/h2-9H,1H3,(H,19,20) |
| InChIKey | DUAQCHQSFJBETH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|