C9H15NO2 — CID 102338359
(4R,5R)-4-tert-butyl-5-ethenyl-1,3-oxazolidin-2-one (PubChem CID 102338359) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (4R,5R)-4-tert-butyl-5-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-tert-butyl-5-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102338359 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (4R,5R)-4-tert-butyl-5-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@H]1OC(=O)N[C@@H]1C(C)(C)C |
| InChI | InChI=1S/C9H15NO2/c1-5-6-7(9(2,3)4)10-8(11)12-6/h5-7H,1H2,2-4H3,(H,10,11)/t6-,7+/m1/s1 |
| InChIKey | ISQONGKPTZFPIG-RQJHMYQMSA-N |
| XLogP | 1.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|