C28H43F3O7SSi — CID 102338799
[(2S,3R,4R,6R)-3-methyl-2-[(E)-2-phenylethenyl]-6-[(1R)-1-(trifluoromethylsulfonyloxy)-2-tri(propan-2-yl)silyloxyethyl]oxan-4-yl] acetate (PubChem CID 102338799) has the molecular formula C28H43F3O7SSi and a molecular weight of 608.79 g/mol. Its IUPAC name is [(2S,3R,4R,6R)-3-methyl-2-[(E)-2-phenylethenyl]-6-[(1R)-1-(trifluoromethylsulfonyloxy)-2-tri(propan-2-yl)silyloxyethyl]oxan-4-yl] acetate.
| Compound Name | [(2S,3R,4R,6R)-3-methyl-2-[(E)-2-phenylethenyl]-6-[(1R)-1-(trifluoromethylsulfonyloxy)-2-tri(propan-2-yl)silyloxyethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 102338799 |
| Molecular Formula | C28H43F3O7SSi |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | [(2S,3R,4R,6R)-3-methyl-2-[(E)-2-phenylethenyl]-6-[(1R)-1-(trifluoromethylsulfonyloxy)-2-tri(propan-2-yl)silyloxyethyl]oxan-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]([C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)OS(=O)(=O)C(F)(F)F)O[C@@H](/C=C/c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C28H43F3O7SSi/c1-18(2)40(19(3)4,20(5)6)35-17-27(38-39(33,34)28(29,30)31)26-16-25(36-22(8)32)21(7)24(37-26)15-14-23-12-10-9-11-13-23/h9-15,18-21,24-27H,16-17H2,1-8H3/b15-14+/t21-,24-,25+,26+,27+/m0/s1 |
| InChIKey | YWVAUBNSOCAYCL-PLSCLZAISA-N |
| XLogP | 6.85 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|