C19H34O10 — CID 102338931
(2S,5R,6R,8R,9R)-2,6,10,10-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxaspiro[4.5]decane-2,6,8-triol (PubChem CID 102338931) has the molecular formula C19H34O10 and a molecular weight of 422.47 g/mol. Its IUPAC name is (2S,5R,6R,8R,9R)-2,6,10,10-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxaspiro[4.5]decane-2,6,8-triol.
| Compound Name | (2S,5R,6R,8R,9R)-2,6,10,10-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxaspiro[4.5]decane-2,6,8-triol |
|---|---|
| PubChem CID | 102338931 |
| Molecular Formula | C19H34O10 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | (2S,5R,6R,8R,9R)-2,6,10,10-tetramethyl-9-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1-oxaspiro[4.5]decane-2,6,8-triol |
| SMILES | CC1(C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)C[C@@](C)(O)[C@@]12CC[C@@](C)(O)O2 |
| InChI | InChI=1S/C19H34O10/c1-16(2)14(28-15-13(24)12(23)11(22)10(8-20)27-15)9(21)7-17(3,25)19(16)6-5-18(4,26)29-19/h9-15,20-26H,5-8H2,1-4H3/t9-,10-,11-,12+,13-,14+,15+,17-,18+,19-/m1/s1 |
| InChIKey | XUSRKYSAUXYMAV-HPTDIWFOSA-N |
| XLogP | -2.03 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |