C45H28N4O3 — CID 102339138
3,4-bis[4-[4-(1,3,4-oxadiazol-2-yl)phenyl]phenyl]-2,5-diphenylcyclopenta-2,4-dien-1-one (PubChem CID 102339138) has the molecular formula C45H28N4O3 and a molecular weight of 672.74 g/mol. Its IUPAC name is 3,4-bis[4-[4-(1,3,4-oxadiazol-2-yl)phenyl]phenyl]-2,5-diphenylcyclopenta-2,4-dien-1-one.
| Compound Name | 3,4-bis[4-[4-(1,3,4-oxadiazol-2-yl)phenyl]phenyl]-2,5-diphenylcyclopenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 102339138 |
| Molecular Formula | C45H28N4O3 |
| Molecular Weight | 672.74 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | 3,4-bis[4-[4-(1,3,4-oxadiazol-2-yl)phenyl]phenyl]-2,5-diphenylcyclopenta-2,4-dien-1-one |
| SMILES | O=C1C(c2ccccc2)=C(c2ccc(-c3ccc(-c4nnco4)cc3)cc2)C(c2ccc(-c3ccc(-c4nnco4)cc3)cc2)=C1c1ccccc1 |
| InChI | InChI=1S/C45H28N4O3/c50-43-41(33-7-3-1-4-8-33)39(35-19-11-29(12-20-35)31-15-23-37(24-16-31)44-48-46-27-51-44)40(42(43)34-9-5-2-6-10-34)36-21-13-30(14-22-36)32-17-25-38(26-18-32)45-49-47-28-52-45/h1-28H |
| InChIKey | YOJHAHFXVAZOBL-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.74 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|