C24H39NO3 — CID 102339340
(2Z,6E,12E,14E)-N-(1,3-dihydroxypropan-2-yl)-12-methylicosa-2,6,12,14,19-pentaenamide (PubChem CID 102339340) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is (2Z,6E,12E,14E)-N-(1,3-dihydroxypropan-2-yl)-12-methylicosa-2,6,12,14,19-pentaenamide.
| Compound Name | (2Z,6E,12E,14E)-N-(1,3-dihydroxypropan-2-yl)-12-methylicosa-2,6,12,14,19-pentaenamide |
|---|---|
| PubChem CID | 102339340 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (2Z,6E,12E,14E)-N-(1,3-dihydroxypropan-2-yl)-12-methylicosa-2,6,12,14,19-pentaenamide |
| SMILES | C=CCCC/C=C/C=C(\C)CCCC/C=C/CC/C=C\C(=O)NC(CO)CO |
| InChI | InChI=1S/C24H39NO3/c1-3-4-5-6-11-14-17-22(2)18-15-12-9-7-8-10-13-16-19-24(28)25-23(20-26)21-27/h3,7-8,11,14,16-17,19,23,26-27H,1,4-6,9-10,12-13,15,18,20-21H2,2H3,(H,25,28)/b8-7+,14-11+,19-16-,22-17+ |
| InChIKey | QZDRALHHNJQOTA-ZWMNDHQQSA-N |
| XLogP | 4.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|