C11H9BrF3NO — CID 102339887
5-bromo-1-methyl-3-(2,2,2-trifluoroethyl)-3H-indol-2-one (PubChem CID 102339887) has the molecular formula C11H9BrF3NO and a molecular weight of 308.10 g/mol. Its IUPAC name is 5-bromo-1-methyl-3-(2,2,2-trifluoroethyl)-3H-indol-2-one.
| Compound Name | 5-bromo-1-methyl-3-(2,2,2-trifluoroethyl)-3H-indol-2-one |
|---|---|
| PubChem CID | 102339887 |
| Molecular Formula | C11H9BrF3NO |
| Molecular Weight | 308.10 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 5-bromo-1-methyl-3-(2,2,2-trifluoroethyl)-3H-indol-2-one |
| SMILES | CN1C(=O)C(CC(F)(F)F)c2cc(Br)ccc21 |
| InChI | InChI=1S/C11H9BrF3NO/c1-16-9-3-2-6(12)4-7(9)8(10(16)17)5-11(13,14)15/h2-4,8H,5H2,1H3 |
| InChIKey | DYBQEDYEWXGVHC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.10 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |