C17H20O6S — CID 102340471
4-O-ethyl 1-O-methyl (2R,5S)-4-hydroxy-8-oxo-2-thiophen-2-ylbicyclo[3.2.1]octane-1,4-dicarboxylate (PubChem CID 102340471) has the molecular formula C17H20O6S and a molecular weight of 352.41 g/mol. Its IUPAC name is 4-O-ethyl 1-O-methyl (2R,5S)-4-hydroxy-8-oxo-2-thiophen-2-ylbicyclo[3.2.1]octane-1,4-dicarboxylate.
| Compound Name | 4-O-ethyl 1-O-methyl (2R,5S)-4-hydroxy-8-oxo-2-thiophen-2-ylbicyclo[3.2.1]octane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 102340471 |
| Molecular Formula | C17H20O6S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 4-O-ethyl 1-O-methyl (2R,5S)-4-hydroxy-8-oxo-2-thiophen-2-ylbicyclo[3.2.1]octane-1,4-dicarboxylate |
| SMILES | CCOC(=O)C1(O)C[C@@H](c2cccs2)C2(C(=O)OC)CC[C@@H]1C2=O |
| InChI | InChI=1S/C17H20O6S/c1-3-23-15(20)17(21)9-11(12-5-4-8-24-12)16(14(19)22-2)7-6-10(17)13(16)18/h4-5,8,10-11,21H,3,6-7,9H2,1-2H3/t10-,11+,16?,17?/m1/s1 |
| InChIKey | YNZXYYGIGZHFJG-ILHRLWLBSA-N |
| XLogP | 1.67 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|