About 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene
17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene (PubChem CID 102340660) has the molecular formula C16H25N
and a molecular weight of 231.38 g/mol. Its IUPAC name is 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene.
Molecular Properties
| Compound Name | 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene |
| PubChem CID | 102340660 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene |
| SMILES | c1cc2nc(c1)CCCCCCCCCCC2 |
| InChI | InChI=1S/C16H25N/c1-2-4-6-8-11-15-13-10-14-16(17-15)12-9-7-5-3-1/h10,13-14H,1-9,11-12H2 |
| InChIKey | BHIOKXYOFQCOOW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene?
The IUPAC name of 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene (CID 102340660) is 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene.
What is the SMILES notation for 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene?
The canonical SMILES for 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene is c1cc2nc(c1)CCCCCCCCCCC2.
What is the InChIKey of 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene?
The InChIKey is BHIOKXYOFQCOOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N/c1-2-4-6-8-11-15-13-10-14-16(17-15)12-9-7-5-3-1/h10,13-14H,1-9,11-12H2.
What are the key properties of 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene?
17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene has a molecular weight of 231.38 g/mol, XLogP of 4.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 17-azabicyclo[11.3.1]heptadeca-1(17),13,15-triene is sourced from PubChem (CID 102340660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).