C25H20ClNO3 — CID 102341393
(1R,10R,11S,16R)-4-chloro-16-(naphthalene-1-carbonyl)-8-oxa-15-azatetracyclo[8.6.0.02,7.011,15]hexadeca-2(7),3,5-trien-9-one (PubChem CID 102341393) has the molecular formula C25H20ClNO3 and a molecular weight of 417.89 g/mol. Its IUPAC name is (1R,10R,11S,16R)-4-chloro-16-(naphthalene-1-carbonyl)-8-oxa-15-azatetracyclo[8.6.0.02,7.011,15]hexadeca-2(7),3,5-trien-9-one.
| Compound Name | (1R,10R,11S,16R)-4-chloro-16-(naphthalene-1-carbonyl)-8-oxa-15-azatetracyclo[8.6.0.02,7.011,15]hexadeca-2(7),3,5-trien-9-one |
|---|---|
| PubChem CID | 102341393 |
| Molecular Formula | C25H20ClNO3 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (1R,10R,11S,16R)-4-chloro-16-(naphthalene-1-carbonyl)-8-oxa-15-azatetracyclo[8.6.0.02,7.011,15]hexadeca-2(7),3,5-trien-9-one |
| SMILES | O=C1Oc2ccc(Cl)cc2[C@H]2[C@@H]1[C@@H]1CCCN1[C@H]2C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H20ClNO3/c26-15-10-11-20-18(13-15)21-22(25(29)30-20)19-9-4-12-27(19)23(21)24(28)17-8-3-6-14-5-1-2-7-16(14)17/h1-3,5-8,10-11,13,19,21-23H,4,9,12H2/t19-,21-,22-,23+/m0/s1 |
| InChIKey | KKJSSMXSTBGDTH-XXTHSBEZSA-N |
| XLogP | 4.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|