C25H36N2S2 — CID 102341471
4-[4-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]-3,5-dimethyl-1H-pyrazole (PubChem CID 102341471) has the molecular formula C25H36N2S2 and a molecular weight of 428.71 g/mol. Its IUPAC name is 4-[4-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]-3,5-dimethyl-1H-pyrazole.
| Compound Name | 4-[4-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]-3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 102341471 |
| Molecular Formula | C25H36N2S2 |
| Molecular Weight | 428.71 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 4-[4-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]-3,5-dimethyl-1H-pyrazole |
| SMILES | CCCCCCc1ccsc1-c1sc(-c2c(C)n[nH]c2C)cc1CCCCCC |
| InChI | InChI=1S/C25H36N2S2/c1-5-7-9-11-13-20-15-16-28-24(20)25-21(14-12-10-8-6-2)17-22(29-25)23-18(3)26-27-19(23)4/h15-17H,5-14H2,1-4H3,(H,26,27) |
| InChIKey | COSOGPHXTGKGAW-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.71 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|