C40H31N3O2 — CID 102341490
(4S)-2-[(Z)-[(3Z)-5,6-diphenyl-3-[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methylidene]isoindol-1-ylidene]methyl]-4-phenyl-4,5-dihydro-1,3-oxazole (PubChem CID 102341490) has the molecular formula C40H31N3O2 and a molecular weight of 585.71 g/mol. Its IUPAC name is (4S)-2-[(Z)-[(3Z)-5,6-diphenyl-3-[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methylidene]isoindol-1-ylidene]methyl]-4-phenyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-2-[(Z)-[(3Z)-5,6-diphenyl-3-[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methylidene]isoindol-1-ylidene]methyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102341490 |
| Molecular Formula | C40H31N3O2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | (4S)-2-[(Z)-[(3Z)-5,6-diphenyl-3-[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methylidene]isoindol-1-ylidene]methyl]-4-phenyl-4,5-dihydro-1,3-oxazole |
| SMILES | C(\C1=N[C@@H](c2ccccc2)CO1)=c1\[nH]/c(=C\C2=N[C@@H](c3ccccc3)CO2)c2cc(-c3ccccc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C40H31N3O2/c1-5-13-27(14-6-1)31-21-33-34(22-32(31)28-15-7-2-8-16-28)36(24-40-43-38(26-45-40)30-19-11-4-12-20-30)41-35(33)23-39-42-37(25-44-39)29-17-9-3-10-18-29/h1-24,37-38,41H,25-26H2/b35-23-,36-24-/t37-,38-/m1/s1 |
| InChIKey | PUDFKCVQQCZGTC-HSTRXFPXSA-N |
| XLogP | 7.40 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |