About 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium
4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium (PubChem CID 102341910) has the molecular formula C33H33N2O4+
and a molecular weight of 521.64 g/mol. Its IUPAC name is 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium.
Molecular Properties
| Compound Name | 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium |
| PubChem CID | 102341910 |
| Molecular Formula | C33H33N2O4+ |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium |
| SMILES | COc1ccc(Cn2c[n+](Cc3ccc(OC)cc3)c(-c3ccc(OC)cc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H33N2O4/c1-36-28-13-5-24(6-14-28)21-34-23-35(22-25-7-15-29(37-2)16-8-25)33(27-11-19-31(39-4)20-12-27)32(34)26-9-17-30(38-3)18-10-26/h5-20,23H,21-22H2,1-4H3/q+1 |
| InChIKey | UTTQHCMCYMAUGT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 45.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium?
The IUPAC name of 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium (CID 102341910) is 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium.
What is the SMILES notation for 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium?
The canonical SMILES for 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium is COc1ccc(Cn2c[n+](Cc3ccc(OC)cc3)c(-c3ccc(OC)cc3)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium?
The InChIKey is UTTQHCMCYMAUGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H33N2O4/c1-36-28-13-5-24(6-14-28)21-34-23-35(22-25-7-15-29(37-2)16-8-25)33(27-11-19-31(39-4)20-12-27)32(34)26-9-17-30(38-3)18-10-26/h5-20,23H,21-22H2,1-4H3/q+1.
What are the key properties of 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium?
4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium has a molecular weight of 521.64 g/mol, XLogP of 6.24, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(4-methoxyphenyl)-1,3-bis[(4-methoxyphenyl)methyl]imidazol-1-ium is sourced from PubChem (CID 102341910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).