About 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone
3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone (PubChem CID 102341992) has the molecular formula C19H31NSe
and a molecular weight of 352.42 g/mol. Its IUPAC name is 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone.
Molecular Properties
| Compound Name | 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone |
| PubChem CID | 102341992 |
| Molecular Formula | C19H31NSe |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone |
| SMILES | C=CCC(C(=[Se])N1CCCC1)C(C)(C=C)CCC=C(C)C |
| InChI | InChI=1S/C19H31NSe/c1-6-11-17(18(21)20-14-8-9-15-20)19(5,7-2)13-10-12-16(3)4/h6-7,12,17H,1-2,8-11,13-15H2,3-5H3 |
| InChIKey | JTNITINFQJBSSC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone?
The IUPAC name of 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone (CID 102341992) is 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone.
What is the SMILES notation for 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone?
The canonical SMILES for 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone is C=CCC(C(=[Se])N1CCCC1)C(C)(C=C)CCC=C(C)C.
What is the InChIKey of 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone?
The InChIKey is JTNITINFQJBSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NSe/c1-6-11-17(18(21)20-14-8-9-15-20)19(5,7-2)13-10-12-16(3)4/h6-7,12,17H,1-2,8-11,13-15H2,3-5H3.
What are the key properties of 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone?
3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone has a molecular weight of 352.42 g/mol, XLogP of 4.51, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-3,7-dimethyl-2-prop-2-enyl-1-pyrrolidin-1-yloct-6-ene-1-selone is sourced from PubChem (CID 102341992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).