C16H25N5O2 — CID 102342025
tert-butyl N-[(E,1R,2S)-2-azido-4-cyano-1-cyclohexylbut-3-enyl]carbamate (PubChem CID 102342025) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl N-[(E,1R,2S)-2-azido-4-cyano-1-cyclohexylbut-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(E,1R,2S)-2-azido-4-cyano-1-cyclohexylbut-3-enyl]carbamate |
|---|---|
| PubChem CID | 102342025 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl N-[(E,1R,2S)-2-azido-4-cyano-1-cyclohexylbut-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1CCCCC1)[C@H](/C=C/C#N)N=[N+]=[N-] |
| InChI | InChI=1S/C16H25N5O2/c1-16(2,3)23-15(22)19-14(12-8-5-4-6-9-12)13(20-21-18)10-7-11-17/h7,10,12-14H,4-6,8-9H2,1-3H3,(H,19,22)/b10-7+/t13-,14+/m0/s1 |
| InChIKey | BXNOUJQZGRFIKM-QZVITLNNSA-N |
| XLogP | 4.22 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|