C18H18F3NO6 — CID 102342274
methyl (4R,4aR,8aS)-8a-hydroxy-4a-nitro-4-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-chromene-2-carboxylate (PubChem CID 102342274) has the molecular formula C18H18F3NO6 and a molecular weight of 401.34 g/mol. Its IUPAC name is methyl (4R,4aR,8aS)-8a-hydroxy-4a-nitro-4-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-chromene-2-carboxylate.
| Compound Name | methyl (4R,4aR,8aS)-8a-hydroxy-4a-nitro-4-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-chromene-2-carboxylate |
|---|---|
| PubChem CID | 102342274 |
| Molecular Formula | C18H18F3NO6 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | methyl (4R,4aR,8aS)-8a-hydroxy-4a-nitro-4-[4-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydro-4H-chromene-2-carboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccc(C(F)(F)F)cc2)[C@]2([N+](=O)[O-])CCCC[C@]2(O)O1 |
| InChI | InChI=1S/C18H18F3NO6/c1-27-15(23)14-10-13(11-4-6-12(7-5-11)18(19,20)21)16(22(25)26)8-2-3-9-17(16,24)28-14/h4-7,10,13,24H,2-3,8-9H2,1H3/t13-,16-,17+/m1/s1 |
| InChIKey | XTCDBGHTOWNOGR-XYPHTWIQSA-N |
| XLogP | 3.15 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|