C15H22FNO3 — CID 102343110
(2S,3S,4S,5S)-2-[4-(4-fluorophenyl)butyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 102343110) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-[4-(4-fluorophenyl)butyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4S,5S)-2-[4-(4-fluorophenyl)butyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 102343110 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2S,3S,4S,5S)-2-[4-(4-fluorophenyl)butyl]-5-(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | OC[C@@H]1N[C@@H](CCCCc2ccc(F)cc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H22FNO3/c16-11-7-5-10(6-8-11)3-1-2-4-12-14(19)15(20)13(9-18)17-12/h5-8,12-15,17-20H,1-4,9H2/t12-,13-,14-,15-/m0/s1 |
| InChIKey | NCIBNAATYWGBOH-AJNGGQMLSA-N |
| XLogP | 0.59 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|