About (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione
(4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione (PubChem CID 102343595) has the molecular formula C27H23NO3
and a molecular weight of 409.49 g/mol. Its IUPAC name is (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione.
Molecular Properties
| Compound Name | (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione |
| PubChem CID | 102343595 |
| Molecular Formula | C27H23NO3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione |
| SMILES | CCCC/C=C1\c2ccccc2C(=O)OC12C(=O)N(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C27H23NO3/c1-2-3-5-16-22-20-14-8-9-15-21(20)25(29)31-27(22)23-17-10-11-18-24(23)28(26(27)30)19-12-6-4-7-13-19/h4,6-18H,2-3,5H2,1H3/b22-16+ |
| InChIKey | KSTGMBVXOUAAEC-CJLVFECKSA-N |
| XLogP | 6.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione?
The IUPAC name of (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione (CID 102343595) is (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione.
What is the SMILES notation for (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione?
The canonical SMILES for (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione is CCCC/C=C1\c2ccccc2C(=O)OC12C(=O)N(c1ccccc1)c1ccccc12.
What is the InChIKey of (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione?
The InChIKey is KSTGMBVXOUAAEC-CJLVFECKSA-N. The full InChI is InChI=1S/C27H23NO3/c1-2-3-5-16-22-20-14-8-9-15-21(20)25(29)31-27(22)23-17-10-11-18-24(23)28(26(27)30)19-12-6-4-7-13-19/h4,6-18H,2-3,5H2,1H3/b22-16+.
What are the key properties of (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione?
(4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione has a molecular weight of 409.49 g/mol, XLogP of 6.00, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4'E)-4'-pentylidene-1-phenylspiro[indole-3,3'-isochromene]-1',2-dione is sourced from PubChem (CID 102343595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).