C36H50N4O12S2 — CID 10234366
N,N'-diethyl-N,N'-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine;methanesulfonic acid (PubChem CID 10234366) has the molecular formula C36H50N4O12S2 and a molecular weight of 794.95 g/mol. Its IUPAC name is N,N'-diethyl-N,N'-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine;methanesulfonic acid.
| Compound Name | N,N'-diethyl-N,N'-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine;methanesulfonic acid |
|---|---|
| PubChem CID | 10234366 |
| Molecular Formula | C36H50N4O12S2 |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.29 |
| IUPAC Name | N,N'-diethyl-N,N'-bis[6-(3,4,5-trimethoxyphenyl)-3-pyridinyl]ethane-1,2-diamine;methanesulfonic acid |
| SMILES | CCN(CCN(CC)c1ccc(-c2cc(OC)c(OC)c(OC)c2)nc1)c1ccc(-c2cc(OC)c(OC)c(OC)c2)nc1.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C34H42N4O6.2CH4O3S/c1-9-37(25-11-13-27(35-21-25)23-17-29(39-3)33(43-7)30(18-23)40-4)15-16-38(10-2)26-12-14-28(36-22-26)24-19-31(41-5)34(44-8)32(20-24)42-6;2*1-5(2,3)4/h11-14,17-22H,9-10,15-16H2,1-8H3;2*1H3,(H,2,3,4) |
| InChIKey | GPTDIHKOPZFSLV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 196.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|