C17H32O2Si — CID 102344017
(2E,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enylhepta-2,6-dien-1-ol (PubChem CID 102344017) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is (2E,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enylhepta-2,6-dien-1-ol.
| Compound Name | (2E,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enylhepta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 102344017 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (2E,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-prop-2-enylhepta-2,6-dien-1-ol |
| SMILES | C=CC[C@@H](/C=C/CO)[C@@H](C=C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O2Si/c1-8-11-16(12-10-13-18)15(9-2)14-19-20(6,7)17(3,4)5/h8-10,12,15-16,18H,1-2,11,13-14H2,3-7H3/b12-10+/t15-,16-/m0/s1 |
| InChIKey | WPITWCINKARZEI-VMNGNHSPSA-N |
| XLogP | 4.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|