C11H13N3OS — CID 102344130
4-pyrimidin-2-yl-1-thia-4-azaspiro[4.4]nonan-3-one (PubChem CID 102344130) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-1-thia-4-azaspiro[4.4]nonan-3-one.
| Compound Name | 4-pyrimidin-2-yl-1-thia-4-azaspiro[4.4]nonan-3-one |
|---|---|
| PubChem CID | 102344130 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-pyrimidin-2-yl-1-thia-4-azaspiro[4.4]nonan-3-one |
| SMILES | O=C1CSC2(CCCC2)N1c1ncccn1 |
| InChI | InChI=1S/C11H13N3OS/c15-9-8-16-11(4-1-2-5-11)14(9)10-12-6-3-7-13-10/h3,6-7H,1-2,4-5,8H2 |
| InChIKey | CQWQAFNAUCPMFS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |