C29H30N2O5 — CID 102344404
(3S,6R,7aR)-3-phenyl-2'-(2,3,4-trimethoxyphenyl)spiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-2,4-dihydro-1H-quinoline]-5-one (PubChem CID 102344404) has the molecular formula C29H30N2O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is (3S,6R,7aR)-3-phenyl-2'-(2,3,4-trimethoxyphenyl)spiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-2,4-dihydro-1H-quinoline]-5-one.
| Compound Name | (3S,6R,7aR)-3-phenyl-2'-(2,3,4-trimethoxyphenyl)spiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-2,4-dihydro-1H-quinoline]-5-one |
|---|---|
| PubChem CID | 102344404 |
| Molecular Formula | C29H30N2O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (3S,6R,7aR)-3-phenyl-2'-(2,3,4-trimethoxyphenyl)spiro[1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6,3'-2,4-dihydro-1H-quinoline]-5-one |
| SMILES | COc1ccc(C2Nc3ccccc3C[C@@]23C[C@@H]2CO[C@@H](c4ccccc4)N2C3=O)c(OC)c1OC |
| InChI | InChI=1S/C29H30N2O5/c1-33-23-14-13-21(24(34-2)25(23)35-3)26-29(15-19-11-7-8-12-22(19)30-26)16-20-17-36-27(31(20)28(29)32)18-9-5-4-6-10-18/h4-14,20,26-27,30H,15-17H2,1-3H3/t20-,26?,27+,29-/m1/s1 |
| InChIKey | YTDACZSVADDYMK-RDMJJMJFSA-N |
| XLogP | 4.74 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |