C19H22N4OS — CID 102344784
1-[[(2S)-1-benzylpyrrolidine-2-carbonyl]amino]-3-phenylthiourea (PubChem CID 102344784) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-[[(2S)-1-benzylpyrrolidine-2-carbonyl]amino]-3-phenylthiourea.
| Compound Name | 1-[[(2S)-1-benzylpyrrolidine-2-carbonyl]amino]-3-phenylthiourea |
|---|---|
| PubChem CID | 102344784 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[[(2S)-1-benzylpyrrolidine-2-carbonyl]amino]-3-phenylthiourea |
| SMILES | O=C(NNC(=S)Nc1ccccc1)[C@@H]1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C19H22N4OS/c24-18(21-22-19(25)20-16-10-5-2-6-11-16)17-12-7-13-23(17)14-15-8-3-1-4-9-15/h1-6,8-11,17H,7,12-14H2,(H,21,24)(H2,20,22,25)/t17-/m0/s1 |
| InChIKey | PATWVHXKCYABIW-KRWDZBQOSA-N |
| XLogP | 2.67 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|