C16H11NO3 — CID 102344842
2-(6-methyl-3,4-dioxocyclohexa-1,5-dien-1-yl)-3-oxo-3-phenylpropanenitrile (PubChem CID 102344842) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 2-(6-methyl-3,4-dioxocyclohexa-1,5-dien-1-yl)-3-oxo-3-phenylpropanenitrile.
| Compound Name | 2-(6-methyl-3,4-dioxocyclohexa-1,5-dien-1-yl)-3-oxo-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 102344842 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-(6-methyl-3,4-dioxocyclohexa-1,5-dien-1-yl)-3-oxo-3-phenylpropanenitrile |
| SMILES | CC1=CC(=O)C(=O)C=C1C(C#N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H11NO3/c1-10-7-14(18)15(19)8-12(10)13(9-17)16(20)11-5-3-2-4-6-11/h2-8,13H,1H3 |
| InChIKey | SUYRLXPNLZALOQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|