C18H18O6 — CID 102344866
(1aS,2S,3S,7bR)-2,3-dihydroxy-5-[2-(4-methoxyphenyl)ethyl]-1a,2,3,7b-tetrahydrooxireno[2,3-f]chromen-7-one (PubChem CID 102344866) has the molecular formula C18H18O6 and a molecular weight of 330.34 g/mol. Its IUPAC name is (1aS,2S,3S,7bR)-2,3-dihydroxy-5-[2-(4-methoxyphenyl)ethyl]-1a,2,3,7b-tetrahydrooxireno[2,3-f]chromen-7-one.
| Compound Name | (1aS,2S,3S,7bR)-2,3-dihydroxy-5-[2-(4-methoxyphenyl)ethyl]-1a,2,3,7b-tetrahydrooxireno[2,3-f]chromen-7-one |
|---|---|
| PubChem CID | 102344866 |
| Molecular Formula | C18H18O6 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (1aS,2S,3S,7bR)-2,3-dihydroxy-5-[2-(4-methoxyphenyl)ethyl]-1a,2,3,7b-tetrahydrooxireno[2,3-f]chromen-7-one |
| SMILES | COc1ccc(CCc2cc(=O)c3c(o2)[C@@H](O)[C@H](O)[C@@H]2O[C@H]32)cc1 |
| InChI | InChI=1S/C18H18O6/c1-22-10-5-2-9(3-6-10)4-7-11-8-12(19)13-16(23-11)14(20)15(21)18-17(13)24-18/h2-3,5-6,8,14-15,17-18,20-21H,4,7H2,1H3/t14-,15-,17+,18-/m0/s1 |
| InChIKey | NCTQHEIGOUNMQS-ONIAQPFYSA-N |
| XLogP | 1.28 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|