C28H37FO2S — CID 102344995
(3R,6E)-1-(2-fluoro-5-methoxyphenyl)-3,7,11-trimethyl-1-phenylsulfanyldodeca-6,10-dien-3-ol (PubChem CID 102344995) has the molecular formula C28H37FO2S and a molecular weight of 456.67 g/mol. Its IUPAC name is (3R,6E)-1-(2-fluoro-5-methoxyphenyl)-3,7,11-trimethyl-1-phenylsulfanyldodeca-6,10-dien-3-ol.
| Compound Name | (3R,6E)-1-(2-fluoro-5-methoxyphenyl)-3,7,11-trimethyl-1-phenylsulfanyldodeca-6,10-dien-3-ol |
|---|---|
| PubChem CID | 102344995 |
| Molecular Formula | C28H37FO2S |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (3R,6E)-1-(2-fluoro-5-methoxyphenyl)-3,7,11-trimethyl-1-phenylsulfanyldodeca-6,10-dien-3-ol |
| SMILES | COc1ccc(F)c(C(C[C@](C)(O)CC/C=C(\C)CCC=C(C)C)Sc2ccccc2)c1 |
| InChI | InChI=1S/C28H37FO2S/c1-21(2)11-9-12-22(3)13-10-18-28(4,30)20-27(32-24-14-7-6-8-15-24)25-19-23(31-5)16-17-26(25)29/h6-8,11,13-17,19,27,30H,9-10,12,18,20H2,1-5H3/b22-13+/t27?,28-/m1/s1 |
| InChIKey | ZLQKTCYKDCECOO-FJRPRSMKSA-N |
| XLogP | 8.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|