C14H18O5 — CID 102345257
methyl (4S)-4-acetyloxy-4-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]pent-2-ynoate (PubChem CID 102345257) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is methyl (4S)-4-acetyloxy-4-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]pent-2-ynoate.
| Compound Name | methyl (4S)-4-acetyloxy-4-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]pent-2-ynoate |
|---|---|
| PubChem CID | 102345257 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | methyl (4S)-4-acetyloxy-4-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-1-yl]pent-2-ynoate |
| SMILES | COC(=O)C#C[C@](C)(OC(C)=O)[C@]12CCCC[C@H]1O2 |
| InChI | InChI=1S/C14H18O5/c1-10(15)18-13(2,9-7-12(16)17-3)14-8-5-4-6-11(14)19-14/h11H,4-6,8H2,1-3H3/t11-,13+,14+/m1/s1 |
| InChIKey | DWJWQUUEUFUOLU-XBFCOCLRSA-N |
| XLogP | 1.20 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|