C23H28O2 — CID 102345304
(8S,13S,14S)-3-cyclopentyloxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 102345304) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is (8S,13S,14S)-3-cyclopentyloxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8S,13S,14S)-3-cyclopentyloxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 102345304 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (8S,13S,14S)-3-cyclopentyloxy-13-methyl-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC=C3c4ccc(OC5CCCC5)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C23H28O2/c1-23-13-12-19-18-9-7-17(25-16-4-2-3-5-16)14-15(18)6-8-20(19)21(23)10-11-22(23)24/h7,9,12,14,16,20-21H,2-6,8,10-11,13H2,1H3/t20-,21+,23+/m1/s1 |
| InChIKey | GAWHMHUOFWXBTK-GIWBLDEGSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |