C24H52B2O6Si2 — CID 102345318
methyl-[2-[methyl-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silyl]ethyl]-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane (PubChem CID 102345318) has the molecular formula C24H52B2O6Si2 and a molecular weight of 514.47 g/mol. Its IUPAC name is methyl-[2-[methyl-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silyl]ethyl]-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane.
| Compound Name | methyl-[2-[methyl-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silyl]ethyl]-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane |
|---|---|
| PubChem CID | 102345318 |
| Molecular Formula | C24H52B2O6Si2 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | methyl-[2-[methyl-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silyl]ethyl]-propan-2-yloxy-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]silane |
| SMILES | CC(C)O[Si](C)(CC[Si](C)(CB1OC(C)(C)C(C)(C)O1)OC(C)C)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H52B2O6Si2/c1-19(2)27-33(13,17-25-29-21(5,6)22(7,8)30-25)15-16-34(14,28-20(3)4)18-26-31-23(9,10)24(11,12)32-26/h19-20H,15-18H2,1-14H3 |
| InChIKey | IXZNISMLWQKESO-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|