C19H16N4O2 — CID 102345449
(7S)-13-(1H-indol-5-yl)-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione (PubChem CID 102345449) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is (7S)-13-(1H-indol-5-yl)-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione.
| Compound Name | (7S)-13-(1H-indol-5-yl)-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione |
|---|---|
| PubChem CID | 102345449 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | (7S)-13-(1H-indol-5-yl)-3,9,11-triazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-triene-2,8-dione |
| SMILES | O=C1Nc2ncc(-c3ccc4[nH]ccc4c3)cc2C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C19H16N4O2/c24-18-16-2-1-7-23(16)19(25)14-9-13(10-21-17(14)22-18)11-3-4-15-12(8-11)5-6-20-15/h3-6,8-10,16,20H,1-2,7H2,(H,21,22,24)/t16-/m0/s1 |
| InChIKey | RDDSYJJNRSGUEY-INIZCTEOSA-N |
| XLogP | 2.79 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |