C20H15Cl2N3O2S — CID 102345487
(11E)-11-benzylidene-4-(2,6-dichlorophenyl)-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one (PubChem CID 102345487) has the molecular formula C20H15Cl2N3O2S and a molecular weight of 432.33 g/mol. Its IUPAC name is (11E)-11-benzylidene-4-(2,6-dichlorophenyl)-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one.
| Compound Name | (11E)-11-benzylidene-4-(2,6-dichlorophenyl)-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one |
|---|---|
| PubChem CID | 102345487 |
| Molecular Formula | C20H15Cl2N3O2S |
| Molecular Weight | 432.33 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | (11E)-11-benzylidene-4-(2,6-dichlorophenyl)-2-oxa-12-thia-3,5,9-triazatricyclo[7.3.0.01,5]dodec-3-en-10-one |
| SMILES | O=C1/C(=C\c2ccccc2)SC23ON=C(c4c(Cl)cccc4Cl)N2CCCN13 |
| InChI | InChI=1S/C20H15Cl2N3O2S/c21-14-8-4-9-15(22)17(14)18-23-27-20-24(18)10-5-11-25(20)19(26)16(28-20)12-13-6-2-1-3-7-13/h1-4,6-9,12H,5,10-11H2/b16-12+ |
| InChIKey | ISZINJDTSLVJBE-FOWTUZBSSA-N |
| XLogP | 4.62 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|