C24H33BO5 — CID 102346153
(4aS,5S,6R,8aS)-5-benzoyl-4a-hydroxy-8a-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 102346153) has the molecular formula C24H33BO5 and a molecular weight of 412.34 g/mol. Its IUPAC name is (4aS,5S,6R,8aS)-5-benzoyl-4a-hydroxy-8a-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,5S,6R,8aS)-5-benzoyl-4a-hydroxy-8a-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 102346153 |
| Molecular Formula | C24H33BO5 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (4aS,5S,6R,8aS)-5-benzoyl-4a-hydroxy-8a-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | CC1(C)OB([C@@H]2CC[C@]3(C)C(=O)CCC[C@]3(O)[C@H]2C(=O)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H33BO5/c1-21(2)22(3,4)30-25(29-21)17-13-15-23(5)18(26)12-9-14-24(23,28)19(17)20(27)16-10-7-6-8-11-16/h6-8,10-11,17,19,28H,9,12-15H2,1-5H3/t17-,19-,23-,24+/m1/s1 |
| InChIKey | UFMLXRFTBLDXON-WRGFRKCQSA-N |
| XLogP | 4.23 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|