C30H53O6PSi — CID 102346225
[(2E,6E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-8-[(1S,6S)-3-methyl-2-oxo-6-prop-1-en-2-ylcyclohex-3-en-1-yl]octa-2,6-dienyl] diethyl phosphate (PubChem CID 102346225) has the molecular formula C30H53O6PSi and a molecular weight of 568.81 g/mol. Its IUPAC name is [(2E,6E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-8-[(1S,6S)-3-methyl-2-oxo-6-prop-1-en-2-ylcyclohex-3-en-1-yl]octa-2,6-dienyl] diethyl phosphate.
| Compound Name | [(2E,6E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-8-[(1S,6S)-3-methyl-2-oxo-6-prop-1-en-2-ylcyclohex-3-en-1-yl]octa-2,6-dienyl] diethyl phosphate |
|---|---|
| PubChem CID | 102346225 |
| Molecular Formula | C30H53O6PSi |
| Molecular Weight | 568.81 g/mol |
| Exact Mass | 568.33 |
| IUPAC Name | [(2E,6E,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyl-8-[(1S,6S)-3-methyl-2-oxo-6-prop-1-en-2-ylcyclohex-3-en-1-yl]octa-2,6-dienyl] diethyl phosphate |
| SMILES | C=C(C)[C@H]1CC=C(C)C(=O)[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)/C(C)=C/CC/C(C)=C/COP(=O)(OCC)OCC |
| InChI | InChI=1S/C30H53O6PSi/c1-13-33-37(32,34-14-2)35-21-20-23(5)16-15-17-25(7)29(36-38(11,12)30(8,9)10)27-26(22(3)4)19-18-24(6)28(27)31/h17-18,20,26-27,29H,3,13-16,19,21H2,1-2,4-12H3/b23-20+,25-17+/t26-,27-,29-/m1/s1 |
| InChIKey | GDHPTUMTGWFKEQ-DNQJRONLSA-N |
| XLogP | 8.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.81 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|