C30H36N6O2S — CID 102346475
31-methyl-26-thia-1,8,16,23,31,35-hexazapentacyclo[21.5.5.13,7.110,14.117,21]hexatriaconta-3(36),4,6,10(35),11,13,17,19,21(34)-nonaene-9,15-dione (PubChem CID 102346475) has the molecular formula C30H36N6O2S and a molecular weight of 544.73 g/mol. Its IUPAC name is 31-methyl-26-thia-1,8,16,23,31,35-hexazapentacyclo[21.5.5.13,7.110,14.117,21]hexatriaconta-3(36),4,6,10(35),11,13,17,19,21(34)-nonaene-9,15-dione.
| Compound Name | 31-methyl-26-thia-1,8,16,23,31,35-hexazapentacyclo[21.5.5.13,7.110,14.117,21]hexatriaconta-3(36),4,6,10(35),11,13,17,19,21(34)-nonaene-9,15-dione |
|---|---|
| PubChem CID | 102346475 |
| Molecular Formula | C30H36N6O2S |
| Molecular Weight | 544.73 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 31-methyl-26-thia-1,8,16,23,31,35-hexazapentacyclo[21.5.5.13,7.110,14.117,21]hexatriaconta-3(36),4,6,10(35),11,13,17,19,21(34)-nonaene-9,15-dione |
| SMILES | CN1CCN2CCSCCN(CC1)Cc1cccc(c1)NC(=O)c1cccc(n1)C(=O)Nc1cccc(c1)C2 |
| InChI | InChI=1S/C30H36N6O2S/c1-34-11-13-35-15-17-39-18-16-36(14-12-34)22-24-6-3-8-26(20-24)32-30(38)28-10-4-9-27(33-28)29(37)31-25-7-2-5-23(19-25)21-35/h2-10,19-20H,11-18,21-22H2,1H3,(H,31,37)(H,32,38) |
| InChIKey | JHVJICXIOQJVRA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |