C15H30O4Si — CID 102346745
2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,3-dimethyloxan-2-yl]acetaldehyde (PubChem CID 102346745) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,3-dimethyloxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,3-dimethyloxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 102346745 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2-[(2R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-3,3-dimethyloxan-2-yl]acetaldehyde |
| SMILES | CC1(C)[C@@H](CC=O)O[C@@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O4Si/c1-14(2,3)20(6,7)19-12-10-13(17)18-11(8-9-16)15(12,4)5/h9,11-13,17H,8,10H2,1-7H3/t11-,12-,13-/m1/s1 |
| InChIKey | KXROTDZMEQOPJN-JHJVBQTASA-N |
| XLogP | 3.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|