C19H14N2O5 — CID 102346753
11-diazo-6,9-dimethoxy-2,3-dihydro-1H-benzo[b]fluorene-4,5,10-trione (PubChem CID 102346753) has the molecular formula C19H14N2O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is 11-diazo-6,9-dimethoxy-2,3-dihydro-1H-benzo[b]fluorene-4,5,10-trione.
| Compound Name | 11-diazo-6,9-dimethoxy-2,3-dihydro-1H-benzo[b]fluorene-4,5,10-trione |
|---|---|
| PubChem CID | 102346753 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 11-diazo-6,9-dimethoxy-2,3-dihydro-1H-benzo[b]fluorene-4,5,10-trione |
| SMILES | COc1ccc(OC)c2c(=O)c3c(=[N+]=[N-])c4c(c=3c(=O)c12)C(=O)CCC4 |
| InChI | InChI=1S/C19H14N2O5/c1-25-10-6-7-11(26-2)14-13(10)18(23)15-12-8(4-3-5-9(12)22)17(21-20)16(15)19(14)24/h6-7H,3-5H2,1-2H3 |
| InChIKey | QAVNITXVUAKNMF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 106.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|