C18H18FNO5S — CID 102346900
ethyl 3-(4-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]-3-oxopropanoate (PubChem CID 102346900) has the molecular formula C18H18FNO5S and a molecular weight of 379.41 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]-3-oxopropanoate.
| Compound Name | ethyl 3-(4-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 102346900 |
| Molecular Formula | C18H18FNO5S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-2-[(4-methylphenyl)sulfonylamino]-3-oxopropanoate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FNO5S/c1-3-25-18(22)16(17(21)13-6-8-14(19)9-7-13)20-26(23,24)15-10-4-12(2)5-11-15/h4-11,16,20H,3H2,1-2H3 |
| InChIKey | GIOHXPDBNVPLAQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|