C19H17F6N2O5P — CID 10234709
[(4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-oxo-4-phenylimidazolidin-1-yl]phosphonic acid (PubChem CID 10234709) has the molecular formula C19H17F6N2O5P and a molecular weight of 498.32 g/mol. Its IUPAC name is [(4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-oxo-4-phenylimidazolidin-1-yl]phosphonic acid.
| Compound Name | [(4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-oxo-4-phenylimidazolidin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 10234709 |
| Molecular Formula | C19H17F6N2O5P |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | [(4R)-4-[[3,5-bis(trifluoromethyl)phenyl]methoxymethyl]-2-oxo-4-phenylimidazolidin-1-yl]phosphonic acid |
| SMILES | O=C1N[C@](COCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)CN1P(=O)(O)O |
| InChI | InChI=1S/C19H17F6N2O5P/c20-18(21,22)14-6-12(7-15(8-14)19(23,24)25)9-32-11-17(13-4-2-1-3-5-13)10-27(16(28)26-17)33(29,30)31/h1-8H,9-11H2,(H,26,28)(H2,29,30,31)/t17-/m1/s1 |
| InChIKey | HWIJHHXWQJMRES-QGZVFWFLSA-N |
| XLogP | 4.25 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|