About (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one
(5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one (PubChem CID 102347591) has the molecular formula C7H8O4
and a molecular weight of 156.14 g/mol. Its IUPAC name is (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one |
| PubChem CID | 102347591 |
| Molecular Formula | C7H8O4 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one |
| SMILES | O=C1C=C[C@]2(CCOCO2)O1 |
| InChI | InChI=1S/C7H8O4/c8-6-1-2-7(11-6)3-4-9-5-10-7/h1-2H,3-5H2/t7-/m1/s1 |
| InChIKey | BOGBSHMYJMZOFS-SSDOTTSWSA-N |
| XLogP | 0.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one?
The IUPAC name of (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one (CID 102347591) is (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one.
What is the SMILES notation for (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one?
The canonical SMILES for (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one is O=C1C=C[C@]2(CCOCO2)O1.
What is the InChIKey of (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one?
The InChIKey is BOGBSHMYJMZOFS-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H8O4/c8-6-1-2-7(11-6)3-4-9-5-10-7/h1-2H,3-5H2/t7-/m1/s1.
What are the key properties of (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one?
(5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one has a molecular weight of 156.14 g/mol, XLogP of 0.19, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1,8,10-trioxaspiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 102347591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).